About (3-propyl-2,3-dihydropyridin-4-yl)methanamine
(3-propyl-2,3-dihydropyridin-4-yl)methanamine (PubChem CID 146670699) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (3-propyl-2,3-dihydropyridin-4-yl)methanamine.
Molecular Properties
| Compound Name | (3-propyl-2,3-dihydropyridin-4-yl)methanamine |
| PubChem CID | 146670699 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (3-propyl-2,3-dihydropyridin-4-yl)methanamine |
| SMILES | CCCC1CN=CC=C1CN |
| InChI | InChI=1S/C9H16N2/c1-2-3-9-7-11-5-4-8(9)6-10/h4-5,9H,2-3,6-7,10H2,1H3 |
| InChIKey | GADUYVFNRVAYHV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-propyl-2,3-dihydropyridin-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propyl-2,3-dihydropyridin-4-yl)methanamine?
The IUPAC name of (3-propyl-2,3-dihydropyridin-4-yl)methanamine (CID 146670699) is (3-propyl-2,3-dihydropyridin-4-yl)methanamine.
What is the SMILES notation for (3-propyl-2,3-dihydropyridin-4-yl)methanamine?
The canonical SMILES for (3-propyl-2,3-dihydropyridin-4-yl)methanamine is CCCC1CN=CC=C1CN.
What is the InChIKey of (3-propyl-2,3-dihydropyridin-4-yl)methanamine?
The InChIKey is GADUYVFNRVAYHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-2-3-9-7-11-5-4-8(9)6-10/h4-5,9H,2-3,6-7,10H2,1H3.
What are the key properties of (3-propyl-2,3-dihydropyridin-4-yl)methanamine?
(3-propyl-2,3-dihydropyridin-4-yl)methanamine has a molecular weight of 152.24 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propyl-2,3-dihydropyridin-4-yl)methanamine is sourced from PubChem (CID 146670699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).