C6H11BrN2 — CID 146674793
4-(bromomethyl)-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 146674793) has the molecular formula C6H11BrN2 and a molecular weight of 191.07 g/mol. Its IUPAC name is 4-(bromomethyl)-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | 4-(bromomethyl)-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 146674793 |
| Molecular Formula | C6H11BrN2 |
| Molecular Weight | 191.07 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | 4-(bromomethyl)-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | NC1=NCCC(CBr)C1 |
| InChI | InChI=1S/C6H11BrN2/c7-4-5-1-2-9-6(8)3-5/h5H,1-4H2,(H2,8,9) |
| InChIKey | KFHWLXUVGAUFIW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.07 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|