About 1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine
1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine (PubChem CID 79521586) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine.
Analyze 1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine?
The IUPAC name of 1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine (CID 79521586) is 1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine is NC1=NCCN1CC1CC1.
What is the InChIKey of 1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine?
The InChIKey is VMXIVFHSDWJWOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c8-7-9-3-4-10(7)5-6-1-2-6/h6H,1-5H2,(H2,8,9).
What are the key properties of 1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine?
1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine has a molecular weight of 139.20 g/mol, XLogP of 0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopropylmethyl)-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 79521586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).