C7H11NS2 — CID 90848617
3-(cyclopropylmethyl)-1,3-thiazolidine-2-thione (PubChem CID 90848617) has the molecular formula C7H11NS2 and a molecular weight of 173.31 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-1,3-thiazolidine-2-thione.
| Compound Name | 3-(cyclopropylmethyl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 90848617 |
| Molecular Formula | C7H11NS2 |
| Molecular Weight | 173.31 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 3-(cyclopropylmethyl)-1,3-thiazolidine-2-thione |
| SMILES | S=C1SCCN1CC1CC1 |
| InChI | InChI=1S/C7H11NS2/c9-7-8(3-4-10-7)5-6-1-2-6/h6H,1-5H2 |
| InChIKey | BFAFPVIHCKIVOH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|