C22H38N6 — CID 144911690
5-[7-(2-amino-4,5-dihydroimidazol-1-yl)hept-1-ynyl]-1-[(4-methylcyclohexyl)methyl]-5,6-dihydro-4H-pyrimidin-2-amine (PubChem CID 144911690) has the molecular formula C22H38N6 and a molecular weight of 386.59 g/mol. Its IUPAC name is 5-[7-(2-amino-4,5-dihydroimidazol-1-yl)hept-1-ynyl]-1-[(4-methylcyclohexyl)methyl]-5,6-dihydro-4H-pyrimidin-2-amine.
| Compound Name | 5-[7-(2-amino-4,5-dihydroimidazol-1-yl)hept-1-ynyl]-1-[(4-methylcyclohexyl)methyl]-5,6-dihydro-4H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 144911690 |
| Molecular Formula | C22H38N6 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 5-[7-(2-amino-4,5-dihydroimidazol-1-yl)hept-1-ynyl]-1-[(4-methylcyclohexyl)methyl]-5,6-dihydro-4H-pyrimidin-2-amine |
| SMILES | CC1CCC(CN2CC(C#CCCCCCN3CCN=C3N)CN=C2N)CC1 |
| InChI | InChI=1S/C22H38N6/c1-18-8-10-19(11-9-18)16-28-17-20(15-26-22(28)24)7-5-3-2-4-6-13-27-14-12-25-21(27)23/h18-20H,2-4,6,8-17H2,1H3,(H2,23,25)(H2,24,26) |
| InChIKey | BYODDBFVKYGMIL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|