C21H32O6 — CID 146682706
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(1S)-1,5,6,7-tetramethyl-3,4-dihydro-2H-naphthalen-1-yl]methoxy]oxane-3,4,5-triol (PubChem CID 146682706) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(1S)-1,5,6,7-tetramethyl-3,4-dihydro-2H-naphthalen-1-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(1S)-1,5,6,7-tetramethyl-3,4-dihydro-2H-naphthalen-1-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 146682706 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(1S)-1,5,6,7-tetramethyl-3,4-dihydro-2H-naphthalen-1-yl]methoxy]oxane-3,4,5-triol |
| SMILES | Cc1cc2c(c(C)c1C)CCC[C@]2(C)CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H32O6/c1-11-8-15-14(13(3)12(11)2)6-5-7-21(15,4)10-26-20-19(25)18(24)17(23)16(9-22)27-20/h8,16-20,22-25H,5-7,9-10H2,1-4H3/t16-,17-,18+,19-,20+,21-/m1/s1 |
| InChIKey | RZUMCDWBHXJPOI-OXZADQLBSA-N |
| XLogP | 1.02 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |