C14H26O4 — CID 146683491
(2R,4E)-4-[(5S)-5-hydroxy-5-[(1R)-1-hydroxyethyl]-2,2-dimethylcyclohexylidene]butane-1,2-diol (PubChem CID 146683491) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is (2R,4E)-4-[(5S)-5-hydroxy-5-[(1R)-1-hydroxyethyl]-2,2-dimethylcyclohexylidene]butane-1,2-diol.
| Compound Name | (2R,4E)-4-[(5S)-5-hydroxy-5-[(1R)-1-hydroxyethyl]-2,2-dimethylcyclohexylidene]butane-1,2-diol |
|---|---|
| PubChem CID | 146683491 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (2R,4E)-4-[(5S)-5-hydroxy-5-[(1R)-1-hydroxyethyl]-2,2-dimethylcyclohexylidene]butane-1,2-diol |
| SMILES | C[C@@H](O)[C@]1(O)CCC(C)(C)/C(=C/C[C@@H](O)CO)C1 |
| InChI | InChI=1S/C14H26O4/c1-10(16)14(18)7-6-13(2,3)11(8-14)4-5-12(17)9-15/h4,10,12,15-18H,5-9H2,1-3H3/b11-4+/t10-,12-,14+/m1/s1 |
| InChIKey | SEHYDASJUXGREN-KUACZAJLSA-N |
| XLogP | 0.98 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|