C20H26O8 — CID 146683556
(2S,3R,4R,5S,6R)-6-(hydroxymethyl)-2-[[(2R)-7-hydroxy-2-penta-1,3-dienyl-2,3-dihydro-1-benzofuran-5-yl]oxy]-5-methoxyoxane-3,4-diol (PubChem CID 146683556) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-2-[[(2R)-7-hydroxy-2-penta-1,3-dienyl-2,3-dihydro-1-benzofuran-5-yl]oxy]-5-methoxyoxane-3,4-diol.
| Compound Name | (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-2-[[(2R)-7-hydroxy-2-penta-1,3-dienyl-2,3-dihydro-1-benzofuran-5-yl]oxy]-5-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 146683556 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-2-[[(2R)-7-hydroxy-2-penta-1,3-dienyl-2,3-dihydro-1-benzofuran-5-yl]oxy]-5-methoxyoxane-3,4-diol |
| SMILES | CC=CC=C[C@H]1Cc2cc(O[C@@H]3O[C@H](CO)[C@@H](OC)[C@H](O)[C@H]3O)cc(O)c2O1 |
| InChI | InChI=1S/C20H26O8/c1-3-4-5-6-12-7-11-8-13(9-14(22)18(11)26-12)27-20-17(24)16(23)19(25-2)15(10-21)28-20/h3-6,8-9,12,15-17,19-24H,7,10H2,1-2H3/t12-,15+,16+,17+,19+,20+/m0/s1 |
| InChIKey | FDEFVNRVFBOZML-BOYOGRNWSA-N |
| XLogP | 0.66 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|