C20H30O3 — CID 146683583
(1S,2S,6R,9S,10R,11S,13R,14R)-13-hydroxy-11-(hydroxymethyl)-2,6,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one (PubChem CID 146683583) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,2S,6R,9S,10R,11S,13R,14R)-13-hydroxy-11-(hydroxymethyl)-2,6,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one.
| Compound Name | (1S,2S,6R,9S,10R,11S,13R,14R)-13-hydroxy-11-(hydroxymethyl)-2,6,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one |
|---|---|
| PubChem CID | 146683583 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,2S,6R,9S,10R,11S,13R,14R)-13-hydroxy-11-(hydroxymethyl)-2,6,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one |
| SMILES | C[C@H]1C=CC(=O)[C@]2(C)CC[C@H]3[C@@H]4[C@@](C)(CO)C[C@@H](O)[C@]4(C)C[C@]132 |
| InChI | InChI=1S/C20H30O3/c1-12-5-6-14(22)19(4)8-7-13-16-17(2,11-21)9-15(23)18(16,3)10-20(12,13)19/h5-6,12-13,15-16,21,23H,7-11H2,1-4H3/t12-,13-,15+,16+,17+,18-,19-,20-/m0/s1 |
| InChIKey | IWKFSFPXCJSJDZ-BQOCRIQKSA-N |
| XLogP | 2.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |