C26H31F4N3O2 — CID 146685329
3-fluoro-N-[2-[[5-methoxy-6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]-2-pyridinyl]oxy]ethyl]propan-1-amine (PubChem CID 146685329) has the molecular formula C26H31F4N3O2 and a molecular weight of 493.55 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[5-methoxy-6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]-2-pyridinyl]oxy]ethyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[2-[[5-methoxy-6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]-2-pyridinyl]oxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 146685329 |
| Molecular Formula | C26H31F4N3O2 |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 3-fluoro-N-[2-[[5-methoxy-6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]-2-pyridinyl]oxy]ethyl]propan-1-amine |
| SMILES | COc1ccc(OCCNCCCF)nc1[C@@H]1C2=C(C[C@@H](C)N1CC(F)(F)F)c1ccccc1C2 |
| InChI | InChI=1S/C26H31F4N3O2/c1-17-14-20-19-7-4-3-6-18(19)15-21(20)25(33(17)16-26(28,29)30)24-22(34-2)8-9-23(32-24)35-13-12-31-11-5-10-27/h3-4,6-9,17,25,31H,5,10-16H2,1-2H3/t17-,25+/m1/s1 |
| InChIKey | PMUPWFKINDTXRL-NSYGIPOTSA-N |
| XLogP | 5.13 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|