C12H13NO — CID 14668688
8,9,10,10a-tetrahydro-7H-benzo[c][1,2]benzoxazine (PubChem CID 14668688) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 8,9,10,10a-tetrahydro-7H-benzo[c][1,2]benzoxazine.
| Compound Name | 8,9,10,10a-tetrahydro-7H-benzo[c][1,2]benzoxazine |
|---|---|
| PubChem CID | 14668688 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 8,9,10,10a-tetrahydro-7H-benzo[c][1,2]benzoxazine |
| SMILES | c1ccc2c(c1)ON=C1CCCCC12 |
| InChI | InChI=1S/C12H13NO/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13-11/h2,4,6,8-9H,1,3,5,7H2 |
| InChIKey | GQAAAQDWPYKUAN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |