C18H24FN3O2S — CID 146704726
methyl 5-[5-[[2-(4-fluorophenyl)-2-methylpropyl]amino]-1,2,4-thiadiazol-3-yl]pentanoate (PubChem CID 146704726) has the molecular formula C18H24FN3O2S and a molecular weight of 365.47 g/mol. Its IUPAC name is methyl 5-[5-[[2-(4-fluorophenyl)-2-methylpropyl]amino]-1,2,4-thiadiazol-3-yl]pentanoate.
| Compound Name | methyl 5-[5-[[2-(4-fluorophenyl)-2-methylpropyl]amino]-1,2,4-thiadiazol-3-yl]pentanoate |
|---|---|
| PubChem CID | 146704726 |
| Molecular Formula | C18H24FN3O2S |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | methyl 5-[5-[[2-(4-fluorophenyl)-2-methylpropyl]amino]-1,2,4-thiadiazol-3-yl]pentanoate |
| SMILES | COC(=O)CCCCc1nsc(NCC(C)(C)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H24FN3O2S/c1-18(2,13-8-10-14(19)11-9-13)12-20-17-21-15(22-25-17)6-4-5-7-16(23)24-3/h8-11H,4-7,12H2,1-3H3,(H,20,21,22) |
| InChIKey | QXGLFEWIKBJHQW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|