C11H13ClN4O3 — CID 14672938
N-[1-[2-(4-chlorophenoxy)ethyl]-4,5-dihydroimidazol-2-yl]nitramide (PubChem CID 14672938) has the molecular formula C11H13ClN4O3 and a molecular weight of 284.70 g/mol. Its IUPAC name is N-[1-[2-(4-chlorophenoxy)ethyl]-4,5-dihydroimidazol-2-yl]nitramide.
| Compound Name | N-[1-[2-(4-chlorophenoxy)ethyl]-4,5-dihydroimidazol-2-yl]nitramide |
|---|---|
| PubChem CID | 14672938 |
| Molecular Formula | C11H13ClN4O3 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N-[1-[2-(4-chlorophenoxy)ethyl]-4,5-dihydroimidazol-2-yl]nitramide |
| SMILES | O=[N+]([O-])NC1=NCCN1CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClN4O3/c12-9-1-3-10(4-2-9)19-8-7-15-6-5-13-11(15)14-16(17)18/h1-4H,5-8H2,(H,13,14) |
| InChIKey | RZWJLTBGLPTNGR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|