C10H10ClN5O2 — CID 54400366
N-[1-[2-(6-chloro-3-pyridinyl)ethenyl]-4,5-dihydroimidazol-2-yl]nitramide (PubChem CID 54400366) has the molecular formula C10H10ClN5O2 and a molecular weight of 267.68 g/mol. Its IUPAC name is N-[1-[2-(6-chloro-3-pyridinyl)ethenyl]-4,5-dihydroimidazol-2-yl]nitramide.
| Compound Name | N-[1-[2-(6-chloro-3-pyridinyl)ethenyl]-4,5-dihydroimidazol-2-yl]nitramide |
|---|---|
| PubChem CID | 54400366 |
| Molecular Formula | C10H10ClN5O2 |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | N-[1-[2-(6-chloro-3-pyridinyl)ethenyl]-4,5-dihydroimidazol-2-yl]nitramide |
| SMILES | O=[N+]([O-])NC1=NCCN1C=Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H10ClN5O2/c11-9-2-1-8(7-13-9)3-5-15-6-4-12-10(15)14-16(17)18/h1-3,5,7H,4,6H2,(H,12,14) |
| InChIKey | VMZNHNWXSVYAIZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|