C17H16ClN3O5 — CID 110832006
4-[2-(4-chlorophenoxy)ethyl]-2,2-dimethyl-6-nitropyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 110832006) has the molecular formula C17H16ClN3O5 and a molecular weight of 377.78 g/mol. Its IUPAC name is 4-[2-(4-chlorophenoxy)ethyl]-2,2-dimethyl-6-nitropyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 4-[2-(4-chlorophenoxy)ethyl]-2,2-dimethyl-6-nitropyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 110832006 |
| Molecular Formula | C17H16ClN3O5 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-[2-(4-chlorophenoxy)ethyl]-2,2-dimethyl-6-nitropyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])nc2N(CCOc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C17H16ClN3O5/c1-17(2)16(22)20(9-10-25-12-5-3-11(18)4-6-12)15-13(26-17)7-8-14(19-15)21(23)24/h3-8H,9-10H2,1-2H3 |
| InChIKey | GTRNYSDINNFRFZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|