C9H11F6NO4 — CID 146757372
2,2,3,3,4,4-hexafluoro-5-[3-hydroxypropyl(methyl)amino]-5-oxopentanoic acid (PubChem CID 146757372) has the molecular formula C9H11F6NO4 and a molecular weight of 311.18 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-5-[3-hydroxypropyl(methyl)amino]-5-oxopentanoic acid.
| Compound Name | 2,2,3,3,4,4-hexafluoro-5-[3-hydroxypropyl(methyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 146757372 |
| Molecular Formula | C9H11F6NO4 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-5-[3-hydroxypropyl(methyl)amino]-5-oxopentanoic acid |
| SMILES | CN(CCCO)C(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C9H11F6NO4/c1-16(3-2-4-17)5(18)7(10,11)9(14,15)8(12,13)6(19)20/h17H,2-4H2,1H3,(H,19,20) |
| InChIKey | ROQQMJZXHGLBQS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|