C21H27NO9S — CID 14676137
methyl 5-[1-hydroxy-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-methylbenzenesulfinate;oxalic acid (PubChem CID 14676137) has the molecular formula C21H27NO9S and a molecular weight of 469.51 g/mol. Its IUPAC name is methyl 5-[1-hydroxy-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-methylbenzenesulfinate;oxalic acid.
| Compound Name | methyl 5-[1-hydroxy-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-methylbenzenesulfinate;oxalic acid |
|---|---|
| PubChem CID | 14676137 |
| Molecular Formula | C21H27NO9S |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | methyl 5-[1-hydroxy-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-methylbenzenesulfinate;oxalic acid |
| SMILES | COc1ccccc1OCCNCC(O)c1ccc(C)c(S(=O)OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H25NO5S.C2H2O4/c1-14-8-9-15(12-19(14)26(22)24-3)16(21)13-20-10-11-25-18-7-5-4-6-17(18)23-2;3-1(4)2(5)6/h4-9,12,16,20-21H,10-11,13H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | VTYCWWINFHDVLG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|