C21H29N3OS — CID 14676276
4-methyl-2-[(2-methyl-8-pentoxyimidazo[1,2-a]pyridin-3-yl)methyl]-5-propyl-1,3-thiazole (PubChem CID 14676276) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is 4-methyl-2-[(2-methyl-8-pentoxyimidazo[1,2-a]pyridin-3-yl)methyl]-5-propyl-1,3-thiazole.
| Compound Name | 4-methyl-2-[(2-methyl-8-pentoxyimidazo[1,2-a]pyridin-3-yl)methyl]-5-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 14676276 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 4-methyl-2-[(2-methyl-8-pentoxyimidazo[1,2-a]pyridin-3-yl)methyl]-5-propyl-1,3-thiazole |
| SMILES | CCCCCOc1cccn2c(Cc3nc(C)c(CCC)s3)c(C)nc12 |
| InChI | InChI=1S/C21H29N3OS/c1-5-7-8-13-25-18-11-9-12-24-17(15(3)23-21(18)24)14-20-22-16(4)19(26-20)10-6-2/h9,11-12H,5-8,10,13-14H2,1-4H3 |
| InChIKey | BHMCLISPBJNHTO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|