C22H24ClN4O+ — CID 146774969
[2-(1-aminobutyl)-5-chloro-3-[[4-(2-cyanophenyl)phenyl]methyl]imidazol-4-yl]methyloxidanium (PubChem CID 146774969) has the molecular formula C22H24ClN4O+ and a molecular weight of 395.91 g/mol. Its IUPAC name is [2-(1-aminobutyl)-5-chloro-3-[[4-(2-cyanophenyl)phenyl]methyl]imidazol-4-yl]methyloxidanium.
| Compound Name | [2-(1-aminobutyl)-5-chloro-3-[[4-(2-cyanophenyl)phenyl]methyl]imidazol-4-yl]methyloxidanium |
|---|---|
| PubChem CID | 146774969 |
| Molecular Formula | C22H24ClN4O+ |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [2-(1-aminobutyl)-5-chloro-3-[[4-(2-cyanophenyl)phenyl]methyl]imidazol-4-yl]methyloxidanium |
| SMILES | CCCC(N)c1nc(Cl)c(C[OH2+])n1Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C22H23ClN4O/c1-2-5-19(25)22-26-21(23)20(14-28)27(22)13-15-8-10-16(11-9-15)18-7-4-3-6-17(18)12-24/h3-4,6-11,19,28H,2,5,13-14,25H2,1H3/p+1 |
| InChIKey | RSNXAQWKTHOVEF-UHFFFAOYSA-O |
| XLogP | 4.15 |
| TPSA | 90.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|