About 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide
4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide (PubChem CID 14678261) has the molecular formula C16H18ClNO4S
and a molecular weight of 355.84 g/mol. Its IUPAC name is 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide |
| PubChem CID | 14678261 |
| Molecular Formula | C16H18ClNO4S |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC(O)(CO)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C16H18ClNO4S/c1-12-9-14(7-8-15(12)17)23(21,22)18-10-16(20,11-19)13-5-3-2-4-6-13/h2-9,18-20H,10-11H2,1H3 |
| InChIKey | BCDNWQWZYQOJQI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide?
The IUPAC name of 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide (CID 14678261) is 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide.
What is the SMILES notation for 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide?
The canonical SMILES for 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide is Cc1cc(S(=O)(=O)NCC(O)(CO)c2ccccc2)ccc1Cl.
What is the InChIKey of 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide?
The InChIKey is BCDNWQWZYQOJQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClNO4S/c1-12-9-14(7-8-15(12)17)23(21,22)18-10-16(20,11-19)13-5-3-2-4-6-13/h2-9,18-20H,10-11H2,1H3.
What are the key properties of 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide?
4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide has a molecular weight of 355.84 g/mol, XLogP of 1.81, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(2,3-dihydroxy-2-phenylpropyl)-3-methylbenzenesulfonamide is sourced from PubChem (CID 14678261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).