About 2-sulfinoiminopropane
2-sulfinoiminopropane (PubChem CID 146807205) has the molecular formula C3H7NO2S
and a molecular weight of 121.16 g/mol. Its IUPAC name is 2-sulfinoiminopropane.
Molecular Properties
| Compound Name | 2-sulfinoiminopropane |
| PubChem CID | 146807205 |
| Molecular Formula | C3H7NO2S |
| Molecular Weight | 121.16 g/mol |
| Exact Mass | 121.02 |
| IUPAC Name | 2-sulfinoiminopropane |
| SMILES | CC(C)=NS(=O)O |
| InChI | InChI=1S/C3H7NO2S/c1-3(2)4-7(5)6/h1-2H3,(H,5,6) |
| InChIKey | ABXSRGGJUKIHTP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfinoiminopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfinoiminopropane?
The IUPAC name of 2-sulfinoiminopropane (CID 146807205) is 2-sulfinoiminopropane.
What is the SMILES notation for 2-sulfinoiminopropane?
The canonical SMILES for 2-sulfinoiminopropane is CC(C)=NS(=O)O.
What is the InChIKey of 2-sulfinoiminopropane?
The InChIKey is ABXSRGGJUKIHTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2S/c1-3(2)4-7(5)6/h1-2H3,(H,5,6).
What are the key properties of 2-sulfinoiminopropane?
2-sulfinoiminopropane has a molecular weight of 121.16 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfinoiminopropane is sourced from PubChem (CID 146807205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).