C20H32O3 — CID 14681720
(6E,11S,14E)-11,16-dihydroxy-2,6,14-trimethyl-10-methylidenehexadeca-2,6,14-trien-4-one (PubChem CID 14681720) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (6E,11S,14E)-11,16-dihydroxy-2,6,14-trimethyl-10-methylidenehexadeca-2,6,14-trien-4-one.
| Compound Name | (6E,11S,14E)-11,16-dihydroxy-2,6,14-trimethyl-10-methylidenehexadeca-2,6,14-trien-4-one |
|---|---|
| PubChem CID | 14681720 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (6E,11S,14E)-11,16-dihydroxy-2,6,14-trimethyl-10-methylidenehexadeca-2,6,14-trien-4-one |
| SMILES | C=C(CC/C=C(\C)CC(=O)C=C(C)C)[C@@H](O)CC/C(C)=C/CO |
| InChI | InChI=1S/C20H32O3/c1-15(2)13-19(22)14-17(4)7-6-8-18(5)20(23)10-9-16(3)11-12-21/h7,11,13,20-21,23H,5-6,8-10,12,14H2,1-4H3/b16-11+,17-7+/t20-/m0/s1 |
| InChIKey | UAAZTLQDFUORHE-BRMFGTPPSA-N |
| XLogP | 4.27 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|