C30H29N7O4S2 — CID 146823428
O-[1-[4-[[3-[7-(3-ethoxy-4-methoxyanilino)-[1,3]thiazolo[5,4-d]pyrimidin-5-yl]benzoyl]amino]phenyl]ethyl] N-aminocarbamothioate (PubChem CID 146823428) has the molecular formula C30H29N7O4S2 and a molecular weight of 615.74 g/mol. Its IUPAC name is O-[1-[4-[[3-[7-(3-ethoxy-4-methoxyanilino)-[1,3]thiazolo[5,4-d]pyrimidin-5-yl]benzoyl]amino]phenyl]ethyl] N-aminocarbamothioate.
| Compound Name | O-[1-[4-[[3-[7-(3-ethoxy-4-methoxyanilino)-[1,3]thiazolo[5,4-d]pyrimidin-5-yl]benzoyl]amino]phenyl]ethyl] N-aminocarbamothioate |
|---|---|
| PubChem CID | 146823428 |
| Molecular Formula | C30H29N7O4S2 |
| Molecular Weight | 615.74 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | O-[1-[4-[[3-[7-(3-ethoxy-4-methoxyanilino)-[1,3]thiazolo[5,4-d]pyrimidin-5-yl]benzoyl]amino]phenyl]ethyl] N-aminocarbamothioate |
| SMILES | CCOc1cc(Nc2nc(-c3cccc(C(=O)Nc4ccc(C(C)OC(=S)NN)cc4)c3)nc3scnc23)ccc1OC |
| InChI | InChI=1S/C30H29N7O4S2/c1-4-40-24-15-22(12-13-23(24)39-3)33-27-25-29(43-16-32-25)36-26(35-27)19-6-5-7-20(14-19)28(38)34-21-10-8-18(9-11-21)17(2)41-30(42)37-31/h5-17H,4,31H2,1-3H3,(H,34,38)(H,37,42)(H,33,35,36) |
| InChIKey | SCMIAXOIJTUTIE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 145.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.74 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|