C27H30N4O2 — CID 146900861
1-imidazo[1,2-a]pyridin-6-yl-6-[1-(1H-indole-5-carbonyl)piperidin-4-yl]hexan-1-one (PubChem CID 146900861) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1-imidazo[1,2-a]pyridin-6-yl-6-[1-(1H-indole-5-carbonyl)piperidin-4-yl]hexan-1-one.
| Compound Name | 1-imidazo[1,2-a]pyridin-6-yl-6-[1-(1H-indole-5-carbonyl)piperidin-4-yl]hexan-1-one |
|---|---|
| PubChem CID | 146900861 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-imidazo[1,2-a]pyridin-6-yl-6-[1-(1H-indole-5-carbonyl)piperidin-4-yl]hexan-1-one |
| SMILES | O=C(CCCCCC1CCN(C(=O)c2ccc3[nH]ccc3c2)CC1)c1ccc2nccn2c1 |
| InChI | InChI=1S/C27H30N4O2/c32-25(23-7-9-26-29-14-17-31(26)19-23)5-3-1-2-4-20-11-15-30(16-12-20)27(33)22-6-8-24-21(18-22)10-13-28-24/h6-10,13-14,17-20,28H,1-5,11-12,15-16H2 |
| InChIKey | OIELEBGVTQDPHA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|