C28H30N4O2 — CID 129142501
N-[4-[1-(naphthalene-2-carbonyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 129142501) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-[4-[1-(naphthalene-2-carbonyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-[4-[1-(naphthalene-2-carbonyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 129142501 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | N-[4-[1-(naphthalene-2-carbonyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | O=C(NCCCCC1CCN(C(=O)c2ccc3ccccc3c2)CC1)c1ccc2nccn2c1 |
| InChI | InChI=1S/C28H30N4O2/c33-27(25-10-11-26-29-15-18-32(26)20-25)30-14-4-3-5-21-12-16-31(17-13-21)28(34)24-9-8-22-6-1-2-7-23(22)19-24/h1-2,6-11,15,18-21H,3-5,12-14,16-17H2,(H,30,33) |
| InChIKey | NKWJUPJPLHNDRF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|