C25H27F3N4O3 — CID 70983749
N-[4-[1-[2-(trifluoromethoxy)benzoyl]piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 70983749) has the molecular formula C25H27F3N4O3 and a molecular weight of 488.51 g/mol. Its IUPAC name is N-[4-[1-[2-(trifluoromethoxy)benzoyl]piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-[4-[1-[2-(trifluoromethoxy)benzoyl]piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 70983749 |
| Molecular Formula | C25H27F3N4O3 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-[4-[1-[2-(trifluoromethoxy)benzoyl]piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | O=C(NCCCCC1CCN(C(=O)c2ccccc2OC(F)(F)F)CC1)c1ccc2nccn2c1 |
| InChI | InChI=1S/C25H27F3N4O3/c26-25(27,28)35-21-7-2-1-6-20(21)24(34)31-14-10-18(11-15-31)5-3-4-12-30-23(33)19-8-9-22-29-13-16-32(22)17-19/h1-2,6-9,13,16-18H,3-5,10-12,14-15H2,(H,30,33) |
| InChIKey | FKVVJRQORGVHKN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|