C22H31N5O2S — CID 90381281
N-[4-[1-(4-methyl-1,3-thiazolidine-5-carbonyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 90381281) has the molecular formula C22H31N5O2S and a molecular weight of 429.59 g/mol. Its IUPAC name is N-[4-[1-(4-methyl-1,3-thiazolidine-5-carbonyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-[4-[1-(4-methyl-1,3-thiazolidine-5-carbonyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 90381281 |
| Molecular Formula | C22H31N5O2S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-[4-[1-(4-methyl-1,3-thiazolidine-5-carbonyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CC1NCSC1C(=O)N1CCC(CCCCNC(=O)c2ccc3nccn3c2)CC1 |
| InChI | InChI=1S/C22H31N5O2S/c1-16-20(30-15-25-16)22(29)26-11-7-17(8-12-26)4-2-3-9-24-21(28)18-5-6-19-23-10-13-27(19)14-18/h5-6,10,13-14,16-17,20,25H,2-4,7-9,11-12,15H2,1H3,(H,24,28) |
| InChIKey | XYBJUULVPGYXIM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|