C24H26F2N4O2 — CID 70984745
N-[4-[1-(2,4-difluorobenzoyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 70984745) has the molecular formula C24H26F2N4O2 and a molecular weight of 440.49 g/mol. Its IUPAC name is N-[4-[1-(2,4-difluorobenzoyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-[4-[1-(2,4-difluorobenzoyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 70984745 |
| Molecular Formula | C24H26F2N4O2 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-[4-[1-(2,4-difluorobenzoyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | O=C(NCCCCC1CCN(C(=O)c2ccc(F)cc2F)CC1)c1ccc2nccn2c1 |
| InChI | InChI=1S/C24H26F2N4O2/c25-19-5-6-20(21(26)15-19)24(32)29-12-8-17(9-13-29)3-1-2-10-28-23(31)18-4-7-22-27-11-14-30(22)16-18/h4-7,11,14-17H,1-3,8-10,12-13H2,(H,28,31) |
| InChIKey | KLHWGNSVOZVWML-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|