C26H21FIN5O — CID 146910491
1-[[2-fluoro-4-(1-iodopyrazol-4-yl)phenyl]methyl]-N-(2-pyridin-2-ylethyl)indole-3-carboxamide (PubChem CID 146910491) has the molecular formula C26H21FIN5O and a molecular weight of 565.39 g/mol. Its IUPAC name is 1-[[2-fluoro-4-(1-iodopyrazol-4-yl)phenyl]methyl]-N-(2-pyridin-2-ylethyl)indole-3-carboxamide.
| Compound Name | 1-[[2-fluoro-4-(1-iodopyrazol-4-yl)phenyl]methyl]-N-(2-pyridin-2-ylethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 146910491 |
| Molecular Formula | C26H21FIN5O |
| Molecular Weight | 565.39 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | 1-[[2-fluoro-4-(1-iodopyrazol-4-yl)phenyl]methyl]-N-(2-pyridin-2-ylethyl)indole-3-carboxamide |
| SMILES | O=C(NCCc1ccccn1)c1cn(Cc2ccc(-c3cnn(I)c3)cc2F)c2ccccc12 |
| InChI | InChI=1S/C26H21FIN5O/c27-24-13-18(20-14-31-33(28)16-20)8-9-19(24)15-32-17-23(22-6-1-2-7-25(22)32)26(34)30-12-10-21-5-3-4-11-29-21/h1-9,11,13-14,16-17H,10,12,15H2,(H,30,34) |
| InChIKey | ABFBLRWYFUHUKK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|