C24H22FN3O2 — CID 166984636
1-[(3-fluorophenyl)methyl]-N-[2-(2-methoxy-3-pyridinyl)ethyl]indole-3-carboxamide (PubChem CID 166984636) has the molecular formula C24H22FN3O2 and a molecular weight of 403.46 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-N-[2-(2-methoxy-3-pyridinyl)ethyl]indole-3-carboxamide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-N-[2-(2-methoxy-3-pyridinyl)ethyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 166984636 |
| Molecular Formula | C24H22FN3O2 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-N-[2-(2-methoxy-3-pyridinyl)ethyl]indole-3-carboxamide |
| SMILES | COc1ncccc1CCNC(=O)c1cn(Cc2cccc(F)c2)c2ccccc12 |
| InChI | InChI=1S/C24H22FN3O2/c1-30-24-18(7-5-12-27-24)11-13-26-23(29)21-16-28(22-10-3-2-9-20(21)22)15-17-6-4-8-19(25)14-17/h2-10,12,14,16H,11,13,15H2,1H3,(H,26,29) |
| InChIKey | IDWASBWDTLGFHA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |