C37H33NOSi — CID 14691547
(3-morpholin-4-yl-1,3-diphenylpropa-1,2-dienyl)-triphenylsilane (PubChem CID 14691547) has the molecular formula C37H33NOSi and a molecular weight of 535.76 g/mol. Its IUPAC name is (3-morpholin-4-yl-1,3-diphenylpropa-1,2-dienyl)-triphenylsilane.
| Compound Name | (3-morpholin-4-yl-1,3-diphenylpropa-1,2-dienyl)-triphenylsilane |
|---|---|
| PubChem CID | 14691547 |
| Molecular Formula | C37H33NOSi |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | (3-morpholin-4-yl-1,3-diphenylpropa-1,2-dienyl)-triphenylsilane |
| SMILES | C(=C(c1ccccc1)N1CCOCC1)=C(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H33NOSi/c1-6-16-31(17-7-1)36(38-26-28-39-29-27-38)30-37(32-18-8-2-9-19-32)40(33-20-10-3-11-21-33,34-22-12-4-13-23-34)35-24-14-5-15-25-35/h1-25H,26-29H2 |
| InChIKey | MBYKIACOYHYDIB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|