C21H22F3N3 — CID 146922887
N-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-imine (PubChem CID 146922887) has the molecular formula C21H22F3N3 and a molecular weight of 373.42 g/mol. Its IUPAC name is N-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-imine.
| Compound Name | N-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-imine |
|---|---|
| PubChem CID | 146922887 |
| Molecular Formula | C21H22F3N3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-imine |
| SMILES | FC(F)(F)c1ccc(C/N=C2\Nc3ccccc3CC23CCNCC3)cc1 |
| InChI | InChI=1S/C21H22F3N3/c22-21(23,24)17-7-5-15(6-8-17)14-26-19-20(9-11-25-12-10-20)13-16-3-1-2-4-18(16)27-19/h1-8,25H,9-14H2,(H,26,27) |
| InChIKey | ADNKHQXJWQWSIJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|