About 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine
1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine (PubChem CID 14692957) has the molecular formula C19H25NO4S4
and a molecular weight of 459.68 g/mol. Its IUPAC name is 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine |
| PubChem CID | 14692957 |
| Molecular Formula | C19H25NO4S4 |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine |
| SMILES | CN(C)C(CSS(=O)(=O)Cc1ccccc1)CSS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H25NO4S4/c1-20(2)19(13-25-27(21,22)15-17-9-5-3-6-10-17)14-26-28(23,24)16-18-11-7-4-8-12-18/h3-12,19H,13-16H2,1-2H3 |
| InChIKey | RQPHGDSIVMHFAS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine?
The IUPAC name of 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine (CID 14692957) is 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine.
What is the SMILES notation for 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine?
The canonical SMILES for 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine is CN(C)C(CSS(=O)(=O)Cc1ccccc1)CSS(=O)(=O)Cc1ccccc1.
What is the InChIKey of 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine?
The InChIKey is RQPHGDSIVMHFAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO4S4/c1-20(2)19(13-25-27(21,22)15-17-9-5-3-6-10-17)14-26-28(23,24)16-18-11-7-4-8-12-18/h3-12,19H,13-16H2,1-2H3.
What are the key properties of 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine?
1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine has a molecular weight of 459.68 g/mol, XLogP of 3.44, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(benzylsulfonylsulfanyl)-N,N-dimethylpropan-2-amine is sourced from PubChem (CID 14692957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).