C16H20N2O2S — CID 155181880
[2-[methyl(sulfamoyl)amino]-3-phenylpropyl]benzene (PubChem CID 155181880) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is [2-[methyl(sulfamoyl)amino]-3-phenylpropyl]benzene.
| Compound Name | [2-[methyl(sulfamoyl)amino]-3-phenylpropyl]benzene |
|---|---|
| PubChem CID | 155181880 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | [2-[methyl(sulfamoyl)amino]-3-phenylpropyl]benzene |
| SMILES | CN(C(Cc1ccccc1)Cc1ccccc1)S(N)(=O)=O |
| InChI | InChI=1S/C16H20N2O2S/c1-18(21(17,19)20)16(12-14-8-4-2-5-9-14)13-15-10-6-3-7-11-15/h2-11,16H,12-13H2,1H3,(H2,17,19,20) |
| InChIKey | OQBBFPYTWOVFBG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |