C28H25N7O — CID 146959028
6-[5-[4-[4-(cyclopropylmethyl)-1,2,4-triazol-3-yl]phenyl]-3-pyridinyl]-11-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one (PubChem CID 146959028) has the molecular formula C28H25N7O and a molecular weight of 475.56 g/mol. Its IUPAC name is 6-[5-[4-[4-(cyclopropylmethyl)-1,2,4-triazol-3-yl]phenyl]-3-pyridinyl]-11-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one.
| Compound Name | 6-[5-[4-[4-(cyclopropylmethyl)-1,2,4-triazol-3-yl]phenyl]-3-pyridinyl]-11-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one |
|---|---|
| PubChem CID | 146959028 |
| Molecular Formula | C28H25N7O |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 6-[5-[4-[4-(cyclopropylmethyl)-1,2,4-triazol-3-yl]phenyl]-3-pyridinyl]-11-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one |
| SMILES | CN1CCn2c(cc3c(-c4cncc(-c5ccc(-c6nncn6CC6CC6)cc5)c4)ccnc32)C1=O |
| InChI | InChI=1S/C28H25N7O/c1-33-10-11-35-25(28(33)36)13-24-23(8-9-30-27(24)35)22-12-21(14-29-15-22)19-4-6-20(7-5-19)26-32-31-17-34(26)16-18-2-3-18/h4-9,12-15,17-18H,2-3,10-11,16H2,1H3 |
| InChIKey | AKFIASUQHSFLRQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|