C25H23N5O3S — CID 153243375
6-[5-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-pyridinyl]-11-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one (PubChem CID 153243375) has the molecular formula C25H23N5O3S and a molecular weight of 473.56 g/mol. Its IUPAC name is 6-[5-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-pyridinyl]-11-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one.
| Compound Name | 6-[5-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-pyridinyl]-11-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one |
|---|---|
| PubChem CID | 153243375 |
| Molecular Formula | C25H23N5O3S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 6-[5-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-pyridinyl]-11-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one |
| SMILES | CN1CCn2c(cc3c(-c4cncc(-c5ccc(N6CCCS6(=O)=O)cc5)c4)ccnc32)C1=O |
| InChI | InChI=1S/C25H23N5O3S/c1-28-10-11-29-23(25(28)31)14-22-21(7-8-27-24(22)29)19-13-18(15-26-16-19)17-3-5-20(6-4-17)30-9-2-12-34(30,32)33/h3-8,13-16H,2,9-12H2,1H3 |
| InChIKey | WRWSRIKTZUICRA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|