C17H15F3N4OS — CID 1469592
thiophen-2-yl-[4-[5-(trifluoromethyl)benzotriazol-1-yl]piperidin-1-yl]methanone (PubChem CID 1469592) has the molecular formula C17H15F3N4OS and a molecular weight of 380.40 g/mol. Its IUPAC name is thiophen-2-yl-[4-[5-(trifluoromethyl)benzotriazol-1-yl]piperidin-1-yl]methanone.
| Compound Name | thiophen-2-yl-[4-[5-(trifluoromethyl)benzotriazol-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 1469592 |
| Molecular Formula | C17H15F3N4OS |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | thiophen-2-yl-[4-[5-(trifluoromethyl)benzotriazol-1-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1cccs1)N1CCC(n2nnc3cc(C(F)(F)F)ccc32)CC1 |
| InChI | InChI=1S/C17H15F3N4OS/c18-17(19,20)11-3-4-14-13(10-11)21-22-24(14)12-5-7-23(8-6-12)16(25)15-2-1-9-26-15/h1-4,9-10,12H,5-8H2 |
| InChIKey | FAGXSXGBHLULFO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |