C19H16F6N4O2S — CID 1469581
5-(trifluoromethyl)-1-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]benzotriazole (PubChem CID 1469581) has the molecular formula C19H16F6N4O2S and a molecular weight of 478.42 g/mol. Its IUPAC name is 5-(trifluoromethyl)-1-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]benzotriazole.
| Compound Name | 5-(trifluoromethyl)-1-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]benzotriazole |
|---|---|
| PubChem CID | 1469581 |
| Molecular Formula | C19H16F6N4O2S |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 5-(trifluoromethyl)-1-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]benzotriazole |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCC(n2nnc3cc(C(F)(F)F)ccc32)CC1 |
| InChI | InChI=1S/C19H16F6N4O2S/c20-18(21,22)12-2-1-3-15(10-12)32(30,31)28-8-6-14(7-9-28)29-17-5-4-13(19(23,24)25)11-16(17)26-27-29/h1-5,10-11,14H,6-9H2 |
| InChIKey | WGDBKOLIYVBBCO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |