C8H12ClS+ — CID 146963742
1-(4-chlorocyclohexa-1,5-dien-1-yl)ethylsulfanium (PubChem CID 146963742) has the molecular formula C8H12ClS+ and a molecular weight of 175.70 g/mol. Its IUPAC name is 1-(4-chlorocyclohexa-1,5-dien-1-yl)ethylsulfanium.
| Compound Name | 1-(4-chlorocyclohexa-1,5-dien-1-yl)ethylsulfanium |
|---|---|
| PubChem CID | 146963742 |
| Molecular Formula | C8H12ClS+ |
| Molecular Weight | 175.70 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 1-(4-chlorocyclohexa-1,5-dien-1-yl)ethylsulfanium |
| SMILES | CC([SH2+])C1=CCC(Cl)C=C1 |
| InChI | InChI=1S/C8H11ClS/c1-6(10)7-2-4-8(9)5-3-7/h2-4,6,8,10H,5H2,1H3/p+1 |
| InChIKey | ALCBXNRZKSELFR-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.70 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|