C5H14N2O — CID 146966482
1-ethoxy-N-methylethane-1,2-diamine (PubChem CID 146966482) has the molecular formula C5H14N2O and a molecular weight of 118.18 g/mol. Its IUPAC name is 1-ethoxy-N-methylethane-1,2-diamine.
| Compound Name | 1-ethoxy-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 146966482 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | 1-ethoxy-N-methylethane-1,2-diamine |
| SMILES | CCOC(CN)NC |
| InChI | InChI=1S/C5H14N2O/c1-3-8-5(4-6)7-2/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | ALPDZTSZYUYGHE-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|