C14H17F3INO2 — CID 146967305
tert-butyl 5-iodo-6-(trifluoromethyl)-1,3,3a,7a-tetrahydroisoindole-2-carboxylate (PubChem CID 146967305) has the molecular formula C14H17F3INO2 and a molecular weight of 415.19 g/mol. Its IUPAC name is tert-butyl 5-iodo-6-(trifluoromethyl)-1,3,3a,7a-tetrahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 5-iodo-6-(trifluoromethyl)-1,3,3a,7a-tetrahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 146967305 |
| Molecular Formula | C14H17F3INO2 |
| Molecular Weight | 415.19 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | tert-butyl 5-iodo-6-(trifluoromethyl)-1,3,3a,7a-tetrahydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2C=C(I)C(C(F)(F)F)=CC2C1 |
| InChI | InChI=1S/C14H17F3INO2/c1-13(2,3)21-12(20)19-6-8-4-10(14(15,16)17)11(18)5-9(8)7-19/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | ALTBBJFTUUOITG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.19 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|