C24H24NP — CID 146983386
[4-[(4-phenylphenyl)-pyrrolidin-2-ylmethyl]phenyl]methylidenephosphane (PubChem CID 146983386) has the molecular formula C24H24NP and a molecular weight of 357.44 g/mol. Its IUPAC name is [4-[(4-phenylphenyl)-pyrrolidin-2-ylmethyl]phenyl]methylidenephosphane.
| Compound Name | [4-[(4-phenylphenyl)-pyrrolidin-2-ylmethyl]phenyl]methylidenephosphane |
|---|---|
| PubChem CID | 146983386 |
| Molecular Formula | C24H24NP |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [4-[(4-phenylphenyl)-pyrrolidin-2-ylmethyl]phenyl]methylidenephosphane |
| SMILES | [H]/P=C/c1ccc(C(c2ccc(-c3ccccc3)cc2)C2CCCN2)cc1 |
| InChI | InChI=1S/C24H24NP/c26-17-18-8-10-21(11-9-18)24(23-7-4-16-25-23)22-14-12-20(13-15-22)19-5-2-1-3-6-19/h1-3,5-6,8-15,17,23-26H,4,7,16H2 |
| InChIKey | AOTKIWUOSPNQLP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|