C10H10FNO2 — CID 146987078
4-fluoro-3-methoxy-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 146987078) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 4-fluoro-3-methoxy-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 146987078 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 4-fluoro-3-methoxy-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | COC1NC(=O)c2ccccc2C1F |
| InChI | InChI=1S/C10H10FNO2/c1-14-10-8(11)6-4-2-3-5-7(6)9(13)12-10/h2-5,8,10H,1H3,(H,12,13) |
| InChIKey | APLTZFCHBRQPID-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |