C14H17BrFNO — CID 146989054
7-[(2-bromo-3-fluoro-6-methoxyphenyl)methyl]-7-azabicyclo[2.2.1]heptane (PubChem CID 146989054) has the molecular formula C14H17BrFNO and a molecular weight of 314.20 g/mol. Its IUPAC name is 7-[(2-bromo-3-fluoro-6-methoxyphenyl)methyl]-7-azabicyclo[2.2.1]heptane.
| Compound Name | 7-[(2-bromo-3-fluoro-6-methoxyphenyl)methyl]-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 146989054 |
| Molecular Formula | C14H17BrFNO |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 7-[(2-bromo-3-fluoro-6-methoxyphenyl)methyl]-7-azabicyclo[2.2.1]heptane |
| SMILES | COc1ccc(F)c(Br)c1CN1C2CCC1CC2 |
| InChI | InChI=1S/C14H17BrFNO/c1-18-13-7-6-12(16)14(15)11(13)8-17-9-2-3-10(17)5-4-9/h6-7,9-10H,2-5,8H2,1H3 |
| InChIKey | APVICCOTGYJBGK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |