C29H36N4O5 — CID 14699592
(E)-but-2-enedioic acid;N-[3-(diethylamino)propyl]-2-(4,5-diphenylpyrazol-1-yl)-N-methylacetamide (PubChem CID 14699592) has the molecular formula C29H36N4O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[3-(diethylamino)propyl]-2-(4,5-diphenylpyrazol-1-yl)-N-methylacetamide.
| Compound Name | (E)-but-2-enedioic acid;N-[3-(diethylamino)propyl]-2-(4,5-diphenylpyrazol-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 14699592 |
| Molecular Formula | C29H36N4O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[3-(diethylamino)propyl]-2-(4,5-diphenylpyrazol-1-yl)-N-methylacetamide |
| SMILES | CCN(CC)CCCN(C)C(=O)Cn1ncc(-c2ccccc2)c1-c1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C25H32N4O.C4H4O4/c1-4-28(5-2)18-12-17-27(3)24(30)20-29-25(22-15-10-7-11-16-22)23(19-26-29)21-13-8-6-9-14-21;5-3(6)1-2-4(7)8/h6-11,13-16,19H,4-5,12,17-18,20H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | SQRAIYXZCGGUDJ-WLHGVMLRSA-N |
| XLogP | 4.12 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|