C16H16I3NO5S — CID 147025439
(2,4,6-triiodophenyl) 5-(methylsulfonylcarbamoyl)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 147025439) has the molecular formula C16H16I3NO5S and a molecular weight of 715.08 g/mol. Its IUPAC name is (2,4,6-triiodophenyl) 5-(methylsulfonylcarbamoyl)bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (2,4,6-triiodophenyl) 5-(methylsulfonylcarbamoyl)bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 147025439 |
| Molecular Formula | C16H16I3NO5S |
| Molecular Weight | 715.08 g/mol |
| Exact Mass | 714.79 |
| IUPAC Name | (2,4,6-triiodophenyl) 5-(methylsulfonylcarbamoyl)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CS(=O)(=O)NC(=O)C1CC2CC1CC2C(=O)Oc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C16H16I3NO5S/c1-26(23,24)20-15(21)10-3-8-2-7(10)4-11(8)16(22)25-14-12(18)5-9(17)6-13(14)19/h5-8,10-11H,2-4H2,1H3,(H,20,21) |
| InChIKey | AWNYWVUGSRLULP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.08 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|