C30H40N6O4 — CID 147036581
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-oxo-2-[6-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypyridazin-3-yl]ethyl]phenyl]urea (PubChem CID 147036581) has the molecular formula C30H40N6O4 and a molecular weight of 548.69 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-oxo-2-[6-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypyridazin-3-yl]ethyl]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-oxo-2-[6-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypyridazin-3-yl]ethyl]phenyl]urea |
|---|---|
| PubChem CID | 147036581 |
| Molecular Formula | C30H40N6O4 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-oxo-2-[6-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypyridazin-3-yl]ethyl]phenyl]urea |
| SMILES | CN1C(C)(C)CC(Oc2ccc(C(=O)Cc3ccc(NC(=O)Nc4cc(C(C)(C)C)on4)cc3)nn2)CC1(C)C |
| InChI | InChI=1S/C30H40N6O4/c1-28(2,3)24-16-25(35-40-24)32-27(38)31-20-11-9-19(10-12-20)15-23(37)22-13-14-26(34-33-22)39-21-17-29(4,5)36(8)30(6,7)18-21/h9-14,16,21H,15,17-18H2,1-8H3,(H2,31,32,35,38) |
| InChIKey | AYPTTZMBAVMBFX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 122.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |