C10H11N2Y- — CID 147049295
5-ethynyl-N,3-dimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium (PubChem CID 147049295) has the molecular formula C10H11N2Y- and a molecular weight of 248.12 g/mol. Its IUPAC name is 5-ethynyl-N,3-dimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium.
| Compound Name | 5-ethynyl-N,3-dimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium |
|---|---|
| PubChem CID | 147049295 |
| Molecular Formula | C10H11N2Y- |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 5-ethynyl-N,3-dimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium |
| SMILES | C#CC1=CC(C)=[C-]N(NC)C1=C.[Y] |
| InChI | InChI=1S/C10H11N2.Y/c1-5-10-6-8(2)7-12(11-4)9(10)3;/h1,6,11H,3H2,2,4H3;/q-1; |
| InChIKey | ABCBUKMXBNTLLY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|