C8H10FN2Y- — CID 147857380
5-fluoro-N,3-dimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium (PubChem CID 147857380) has the molecular formula C8H10FN2Y- and a molecular weight of 242.09 g/mol. Its IUPAC name is 5-fluoro-N,3-dimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium.
| Compound Name | 5-fluoro-N,3-dimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium |
|---|---|
| PubChem CID | 147857380 |
| Molecular Formula | C8H10FN2Y- |
| Molecular Weight | 242.09 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 5-fluoro-N,3-dimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium |
| SMILES | C=C1C(F)=CC(C)=[C-]N1NC.[Y] |
| InChI | InChI=1S/C8H10FN2.Y/c1-6-4-8(9)7(2)11(5-6)10-3;/h4,10H,2H2,1,3H3;/q-1; |
| InChIKey | ARGBTWQYBQVGQE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.09 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|