C10H12N2 — CID 147049296
3-ethynyl-N,5-dimethyl-2-methylidenepyridin-1-amine (PubChem CID 147049296) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-ethynyl-N,5-dimethyl-2-methylidenepyridin-1-amine.
| Compound Name | 3-ethynyl-N,5-dimethyl-2-methylidenepyridin-1-amine |
|---|---|
| PubChem CID | 147049296 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-ethynyl-N,5-dimethyl-2-methylidenepyridin-1-amine |
| SMILES | C#CC1=CC(C)=CN(NC)C1=C |
| InChI | InChI=1S/C10H12N2/c1-5-10-6-8(2)7-12(11-4)9(10)3/h1,6-7,11H,3H2,2,4H3 |
| InChIKey | JVSLJOZGCLZCFN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|